C18H20N2O3 — CID 110729888
N-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-2-phenoxyacetamide (PubChem CID 110729888) has the molecular formula C18H20N2O3 and a molecular weight of 312.37 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-2-phenoxyacetamide.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 110729888 |
| Molecular Formula | C18H20N2O3 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzoxazin-4-yl)ethyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)NCCN1CCOc2ccccc21 |
| InChI | InChI=1S/C18H20N2O3/c21-18(14-23-15-6-2-1-3-7-15)19-10-11-20-12-13-22-17-9-5-4-8-16(17)20/h1-9H,10-14H2,(H,19,21) |
| InChIKey | CWYSNNVHGBGZTG-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |