C25H25NO3 — CID 59963099
4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 59963099) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine.
| Compound Name | 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 59963099 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | C/C(=C/c1ccc(OCCN2CCOc3ccccc32)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c1-20(29-23-7-3-2-4-8-23)19-21-11-13-22(14-12-21)27-17-15-26-16-18-28-25-10-6-5-9-24(25)26/h2-14,19H,15-18H2,1H3/b20-19- |
| InChIKey | JPTXTULCHYVUCV-VXPUYCOJSA-N |
| XLogP | 5.40 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|