About 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine
4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine (PubChem CID 59963099) has the molecular formula C25H25NO3
and a molecular weight of 387.48 g/mol. Its IUPAC name is 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 59963099 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine |
| SMILES | C/C(=C/c1ccc(OCCN2CCOc3ccccc32)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c1-20(29-23-7-3-2-4-8-23)19-21-11-13-22(14-12-21)27-17-15-26-16-18-28-25-10-6-5-9-24(25)26/h2-14,19H,15-18H2,1H3/b20-19- |
| InChIKey | JPTXTULCHYVUCV-VXPUYCOJSA-N |
| XLogP | 5.40 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine (CID 59963099) is 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine is C/C(=C/c1ccc(OCCN2CCOc3ccccc32)cc1)Oc1ccccc1.
What is the InChIKey of 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine?
The InChIKey is JPTXTULCHYVUCV-VXPUYCOJSA-N. The full InChI is InChI=1S/C25H25NO3/c1-20(29-23-7-3-2-4-8-23)19-21-11-13-22(14-12-21)27-17-15-26-16-18-28-25-10-6-5-9-24(25)26/h2-14,19H,15-18H2,1H3/b20-19-.
What are the key properties of 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine?
4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine has a molecular weight of 387.48 g/mol, XLogP of 5.40, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[4-[(Z)-2-phenoxyprop-1-enyl]phenoxy]ethyl]-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 59963099), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).