C21H23NO4 — CID 20752827
4-[2-[4-[(Z)-2-ethoxyprop-1-enyl]phenoxy]ethyl]-1,4-benzoxazin-3-one (PubChem CID 20752827) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 4-[2-[4-[(Z)-2-ethoxyprop-1-enyl]phenoxy]ethyl]-1,4-benzoxazin-3-one.
| Compound Name | 4-[2-[4-[(Z)-2-ethoxyprop-1-enyl]phenoxy]ethyl]-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 20752827 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 4-[2-[4-[(Z)-2-ethoxyprop-1-enyl]phenoxy]ethyl]-1,4-benzoxazin-3-one |
| SMILES | CCO/C(C)=C\c1ccc(OCCN2C(=O)COc3ccccc32)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-3-24-16(2)14-17-8-10-18(11-9-17)25-13-12-22-19-6-4-5-7-20(19)26-15-21(22)23/h4-11,14H,3,12-13,15H2,1-2H3/b16-14- |
| InChIKey | XEUIGOOVYGXDRV-PEZBUJJGSA-N |
| XLogP | 3.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|