C18H16N2O7 — CID 18886672
2-(4-nitrophenoxy)ethyl 2-(3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 18886672) has the molecular formula C18H16N2O7 and a molecular weight of 372.33 g/mol. Its IUPAC name is 2-(4-nitrophenoxy)ethyl 2-(3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | 2-(4-nitrophenoxy)ethyl 2-(3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 18886672 |
| Molecular Formula | C18H16N2O7 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-(4-nitrophenoxy)ethyl 2-(3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | O=C(CN1C(=O)COc2ccccc21)OCCOc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H16N2O7/c21-17-12-27-16-4-2-1-3-15(16)19(17)11-18(22)26-10-9-25-14-7-5-13(6-8-14)20(23)24/h1-8H,9-12H2 |
| InChIKey | MOAWTJPYSKAKCV-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|