C20H17N3O5 — CID 55321644
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate (PubChem CID 55321644) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate |
|---|---|
| PubChem CID | 55321644 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] 2-(3-oxo-1,4-benzoxazin-4-yl)acetate |
| SMILES | N#CCN(C(=O)COC(=O)CN1C(=O)COc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O5/c21-10-11-22(15-6-2-1-3-7-15)18(24)14-28-20(26)12-23-16-8-4-5-9-17(16)27-13-19(23)25/h1-9H,11-14H2 |
| InChIKey | LAAQMLTVVGGFDX-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 99.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|