C22H22N2O5 — CID 8645106
[2-oxo-2-(N-prop-2-enylanilino)ethyl] 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 8645106) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [2-oxo-2-(N-prop-2-enylanilino)ethyl] 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | [2-oxo-2-(N-prop-2-enylanilino)ethyl] 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 8645106 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [2-oxo-2-(N-prop-2-enylanilino)ethyl] 3-(3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | C=CCN(C(=O)COC(=O)CCN1C(=O)COc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O5/c1-2-13-23(17-8-4-3-5-9-17)20(25)16-29-22(27)12-14-24-18-10-6-7-11-19(18)28-15-21(24)26/h2-11H,1,12-16H2 |
| InChIKey | XCKSEXAVPPQSQW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|