C17H20N2O3 — CID 7958845
[2-[N-(cyanomethyl)anilino]-2-oxoethyl] cyclohexanecarboxylate (PubChem CID 7958845) has the molecular formula C17H20N2O3 and a molecular weight of 300.36 g/mol. Its IUPAC name is [2-[N-(cyanomethyl)anilino]-2-oxoethyl] cyclohexanecarboxylate.
| Compound Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 7958845 |
| Molecular Formula | C17H20N2O3 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [2-[N-(cyanomethyl)anilino]-2-oxoethyl] cyclohexanecarboxylate |
| SMILES | N#CCN(C(=O)COC(=O)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O3/c18-11-12-19(15-9-5-2-6-10-15)16(20)13-22-17(21)14-7-3-1-4-8-14/h2,5-6,9-10,14H,1,3-4,7-8,12-13H2 |
| InChIKey | IHRBZTGDXWAJAK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|