C15H20N4O — CID 102984942
2-[(3R)-3-aminopiperidin-1-yl]-N-(cyanomethyl)-N-phenylacetamide (PubChem CID 102984942) has the molecular formula C15H20N4O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-[(3R)-3-aminopiperidin-1-yl]-N-(cyanomethyl)-N-phenylacetamide.
| Compound Name | 2-[(3R)-3-aminopiperidin-1-yl]-N-(cyanomethyl)-N-phenylacetamide |
|---|---|
| PubChem CID | 102984942 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-[(3R)-3-aminopiperidin-1-yl]-N-(cyanomethyl)-N-phenylacetamide |
| SMILES | N#CCN(C(=O)CN1CCC[C@@H](N)C1)c1ccccc1 |
| InChI | InChI=1S/C15H20N4O/c16-8-10-19(14-6-2-1-3-7-14)15(20)12-18-9-4-5-13(17)11-18/h1-3,6-7,13H,4-5,9-12,17H2/t13-/m1/s1 |
| InChIKey | UNRUGAIUAJXUCT-CYBMUJFWSA-N |
| XLogP | 0.97 |
| TPSA | 73.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|