C15H17NO6 — CID 67576848
ethyl 3-(6-acetyloxy-3-oxo-1,4-benzoxazin-4-yl)propanoate (PubChem CID 67576848) has the molecular formula C15H17NO6 and a molecular weight of 307.30 g/mol. Its IUPAC name is ethyl 3-(6-acetyloxy-3-oxo-1,4-benzoxazin-4-yl)propanoate.
| Compound Name | ethyl 3-(6-acetyloxy-3-oxo-1,4-benzoxazin-4-yl)propanoate |
|---|---|
| PubChem CID | 67576848 |
| Molecular Formula | C15H17NO6 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl 3-(6-acetyloxy-3-oxo-1,4-benzoxazin-4-yl)propanoate |
| SMILES | CCOC(=O)CCN1C(=O)COc2ccc(OC(C)=O)cc21 |
| InChI | InChI=1S/C15H17NO6/c1-3-20-15(19)6-7-16-12-8-11(22-10(2)17)4-5-13(12)21-9-14(16)18/h4-5,8H,3,6-7,9H2,1-2H3 |
| InChIKey | IMXYXJHVJNZFHB-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|