C18H23NO6 — CID 174609126
ethyl 4-(6-acetyloxy-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoate (PubChem CID 174609126) has the molecular formula C18H23NO6 and a molecular weight of 349.38 g/mol. Its IUPAC name is ethyl 4-(6-acetyloxy-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoate.
| Compound Name | ethyl 4-(6-acetyloxy-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoate |
|---|---|
| PubChem CID | 174609126 |
| Molecular Formula | C18H23NO6 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | ethyl 4-(6-acetyloxy-2,2-dimethyl-3-oxo-1,4-benzoxazin-4-yl)butanoate |
| SMILES | CCOC(=O)CCCN1C(=O)C(C)(C)Oc2ccc(OC(C)=O)cc21 |
| InChI | InChI=1S/C18H23NO6/c1-5-23-16(21)7-6-10-19-14-11-13(24-12(2)20)8-9-15(14)25-18(3,4)17(19)22/h8-9,11H,5-7,10H2,1-4H3 |
| InChIKey | FAHAHJWLFDELQG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|