C14H20N2O2 — CID 28816003
6-amino-4-butyl-2,2-dimethyl-1,4-benzoxazin-3-one (PubChem CID 28816003) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 6-amino-4-butyl-2,2-dimethyl-1,4-benzoxazin-3-one.
| Compound Name | 6-amino-4-butyl-2,2-dimethyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 28816003 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 6-amino-4-butyl-2,2-dimethyl-1,4-benzoxazin-3-one |
| SMILES | CCCCN1C(=O)C(C)(C)Oc2ccc(N)cc21 |
| InChI | InChI=1S/C14H20N2O2/c1-4-5-8-16-11-9-10(15)6-7-12(11)18-14(2,3)13(16)17/h6-7,9H,4-5,8,15H2,1-3H3 |
| InChIKey | VOFWTKOWHPKUIR-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|