C16H16ClF3N4O — CID 171828845
2-chloro-N-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]-5-(trifluoromethyl)pyrimidin-4-amine (PubChem CID 171828845) has the molecular formula C16H16ClF3N4O and a molecular weight of 372.78 g/mol. Its IUPAC name is 2-chloro-N-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]-5-(trifluoromethyl)pyrimidin-4-amine.
| Compound Name | 2-chloro-N-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]-5-(trifluoromethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 171828845 |
| Molecular Formula | C16H16ClF3N4O |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 2-chloro-N-[3-(2,3-dihydro-1,4-benzoxazin-4-yl)propyl]-5-(trifluoromethyl)pyrimidin-4-amine |
| SMILES | FC(F)(F)c1cnc(Cl)nc1NCCCN1CCOc2ccccc21 |
| InChI | InChI=1S/C16H16ClF3N4O/c17-15-22-10-11(16(18,19)20)14(23-15)21-6-3-7-24-8-9-25-13-5-2-1-4-12(13)24/h1-2,4-5,10H,3,6-9H2,(H,21,22,23) |
| InChIKey | JBOGEPDIYODYNF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|