C12H13NO3 — CID 117311956
8-(isocyanatomethyl)-6-methyl-3,4-dihydro-2H-1,5-benzodioxepine (PubChem CID 117311956) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 8-(isocyanatomethyl)-6-methyl-3,4-dihydro-2H-1,5-benzodioxepine.
| Compound Name | 8-(isocyanatomethyl)-6-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
|---|---|
| PubChem CID | 117311956 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | 8-(isocyanatomethyl)-6-methyl-3,4-dihydro-2H-1,5-benzodioxepine |
| SMILES | Cc1cc(CN=C=O)cc2c1OCCCO2 |
| InChI | InChI=1S/C12H13NO3/c1-9-5-10(7-13-8-14)6-11-12(9)16-4-2-3-15-11/h5-6H,2-4,7H2,1H3 |
| InChIKey | VCNASKPYUFXXFA-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|