C14H18N2O3 — CID 117114762
tert-butyl N-[5-(isocyanatomethyl)-2-methylphenyl]carbamate (PubChem CID 117114762) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is tert-butyl N-[5-(isocyanatomethyl)-2-methylphenyl]carbamate.
| Compound Name | tert-butyl N-[5-(isocyanatomethyl)-2-methylphenyl]carbamate |
|---|---|
| PubChem CID | 117114762 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | tert-butyl N-[5-(isocyanatomethyl)-2-methylphenyl]carbamate |
| SMILES | Cc1ccc(CN=C=O)cc1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18N2O3/c1-10-5-6-11(8-15-9-17)7-12(10)16-13(18)19-14(2,3)4/h5-7H,8H2,1-4H3,(H,16,18) |
| InChIKey | VODKKKOJAZGUAH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|