C11H10N2O2 — CID 117290752
7-(isocyanatomethyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 117290752) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 7-(isocyanatomethyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(isocyanatomethyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 117290752 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 7-(isocyanatomethyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C=NCc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C11H10N2O2/c14-7-12-6-8-1-2-9-3-4-11(15)13-10(9)5-8/h1-2,5H,3-4,6H2,(H,13,15) |
| InChIKey | VVEXKDNJLJHMMB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|