C13H17NO2 — CID 129209031
7-(4-hydroxybutyl)-3,4-dihydro-1H-quinolin-2-one (PubChem CID 129209031) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 7-(4-hydroxybutyl)-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-(4-hydroxybutyl)-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 129209031 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 7-(4-hydroxybutyl)-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(CCCCO)cc2N1 |
| InChI | InChI=1S/C13H17NO2/c15-8-2-1-3-10-4-5-11-6-7-13(16)14-12(11)9-10/h4-5,9,15H,1-3,6-8H2,(H,14,16) |
| InChIKey | QDKASXHQJLBMKV-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|