C12H16N2O3 — CID 21073845
7-(4-hydroxybutoxy)-3,4-dihydro-1H-1,6-naphthyridin-2-one (PubChem CID 21073845) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is 7-(4-hydroxybutoxy)-3,4-dihydro-1H-1,6-naphthyridin-2-one.
| Compound Name | 7-(4-hydroxybutoxy)-3,4-dihydro-1H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 21073845 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 7-(4-hydroxybutoxy)-3,4-dihydro-1H-1,6-naphthyridin-2-one |
| SMILES | O=C1CCc2cnc(OCCCCO)cc2N1 |
| InChI | InChI=1S/C12H16N2O3/c15-5-1-2-6-17-12-7-10-9(8-13-12)3-4-11(16)14-10/h7-8,15H,1-6H2,(H,14,16) |
| InChIKey | HKLBZPCWEKDCGP-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|