C18H30N2O4S — CID 170973995
7-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;5,5-dimethylhexanoic acid;sulfanol (PubChem CID 170973995) has the molecular formula C18H30N2O4S and a molecular weight of 370.52 g/mol. Its IUPAC name is 7-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;5,5-dimethylhexanoic acid;sulfanol.
| Compound Name | 7-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;5,5-dimethylhexanoic acid;sulfanol |
|---|---|
| PubChem CID | 170973995 |
| Molecular Formula | C18H30N2O4S |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 7-(aminomethyl)-3,4-dihydro-1H-quinolin-2-one;5,5-dimethylhexanoic acid;sulfanol |
| SMILES | CC(C)(C)CCCC(=O)O.NCc1ccc2c(c1)NC(=O)CC2.OS |
| InChI | InChI=1S/C10H12N2O.C8H16O2.H2OS/c11-6-7-1-2-8-3-4-10(13)12-9(8)5-7;1-8(2,3)6-4-5-7(9)10;1-2/h1-2,5H,3-4,6,11H2,(H,12,13);4-6H2,1-3H3,(H,9,10);1-2H |
| InChIKey | CCDYHCXCGUDQIJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|