C20H26N2O3S — CID 174776190
4-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)amino]benzenesulfonamide (PubChem CID 174776190) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is 4-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 174776190 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 4-[(2,2,5,7,8-pentamethyl-3,4-dihydrochromen-6-yl)amino]benzenesulfonamide |
| SMILES | Cc1c(C)c2c(c(C)c1Nc1ccc(S(N)(=O)=O)cc1)CCC(C)(C)O2 |
| InChI | InChI=1S/C20H26N2O3S/c1-12-13(2)19-17(10-11-20(4,5)25-19)14(3)18(12)22-15-6-8-16(9-7-15)26(21,23)24/h6-9,22H,10-11H2,1-5H3,(H2,21,23,24) |
| InChIKey | KRXDURCZPDJYEM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |