C11H13N3O3S — CID 15764446
4-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]benzenesulfonamide (PubChem CID 15764446) has the molecular formula C11H13N3O3S and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]benzenesulfonamide.
| Compound Name | 4-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 15764446 |
| Molecular Formula | C11H13N3O3S |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.07 |
| IUPAC Name | 4-[(3,4-dimethyl-1,2-oxazol-5-yl)amino]benzenesulfonamide |
| SMILES | Cc1noc(Nc2ccc(S(N)(=O)=O)cc2)c1C |
| InChI | InChI=1S/C11H13N3O3S/c1-7-8(2)14-17-11(7)13-9-3-5-10(6-4-9)18(12,15)16/h3-6,13H,1-2H3,(H2,12,15,16) |
| InChIKey | OMNLVOXPYRHTTD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |