C22H29N3O3 — CID 92859139
4-amino-N-[(Z)-(9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)amino]butanamide (PubChem CID 92859139) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is 4-amino-N-[(Z)-(9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)amino]butanamide.
| Compound Name | 4-amino-N-[(Z)-(9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)amino]butanamide |
|---|---|
| PubChem CID | 92859139 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-amino-N-[(Z)-(9,9-dimethyl-1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromen-5-ylidene)amino]butanamide |
| SMILES | CC1(C)CCc2cc3c4c(/c(=N/NC(=O)CCCN)oc3cc2O1)CCCC4 |
| InChI | InChI=1S/C22H29N3O3/c1-22(2)10-9-14-12-17-15-6-3-4-7-16(15)21(25-24-20(26)8-5-11-23)27-19(17)13-18(14)28-22/h12-13H,3-11,23H2,1-2H3,(H,24,26)/b25-21- |
| InChIKey | GZGCODLZPUQCDP-DAFNUICNSA-N |
| XLogP | 3.09 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|