C28H29FN2O4 — CID 95369235
[(Z)-spiro[1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromene-9,1'-cyclohexane]-5-ylideneamino] N-(4-fluorophenyl)carbamate (PubChem CID 95369235) has the molecular formula C28H29FN2O4 and a molecular weight of 476.55 g/mol. Its IUPAC name is [(Z)-spiro[1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromene-9,1'-cyclohexane]-5-ylideneamino] N-(4-fluorophenyl)carbamate.
| Compound Name | [(Z)-spiro[1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromene-9,1'-cyclohexane]-5-ylideneamino] N-(4-fluorophenyl)carbamate |
|---|---|
| PubChem CID | 95369235 |
| Molecular Formula | C28H29FN2O4 |
| Molecular Weight | 476.55 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | [(Z)-spiro[1,2,3,4,10,11-hexahydroisochromeno[4,3-g]chromene-9,1'-cyclohexane]-5-ylideneamino] N-(4-fluorophenyl)carbamate |
| SMILES | O=C(Nc1ccc(F)cc1)O/N=c1\oc2cc3c(cc2c2c1CCCC2)CCC1(CCCCC1)O3 |
| InChI | InChI=1S/C28H29FN2O4/c29-19-8-10-20(11-9-19)30-27(32)35-31-26-22-7-3-2-6-21(22)23-16-18-12-15-28(13-4-1-5-14-28)34-24(18)17-25(23)33-26/h8-11,16-17H,1-7,12-15H2,(H,30,32)/b31-26- |
| InChIKey | JQURJDFKHCUWRS-ZXPTYKNPSA-N |
| XLogP | 6.54 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.55 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|