C18H16O6 — CID 139081756
(2R)-5,10-dihydroxy-2-(hydroxymethyl)-1,1-dimethyl-2H-furo[2,3-c]xanthen-6-one (PubChem CID 139081756) has the molecular formula C18H16O6 and a molecular weight of 328.32 g/mol. Its IUPAC name is (2R)-5,10-dihydroxy-2-(hydroxymethyl)-1,1-dimethyl-2H-furo[2,3-c]xanthen-6-one.
| Compound Name | (2R)-5,10-dihydroxy-2-(hydroxymethyl)-1,1-dimethyl-2H-furo[2,3-c]xanthen-6-one |
|---|---|
| PubChem CID | 139081756 |
| Molecular Formula | C18H16O6 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | (2R)-5,10-dihydroxy-2-(hydroxymethyl)-1,1-dimethyl-2H-furo[2,3-c]xanthen-6-one |
| SMILES | CC1(C)c2c(cc(O)c3c(=O)c4cccc(O)c4oc23)O[C@H]1CO |
| InChI | InChI=1S/C18H16O6/c1-18(2)12(7-19)23-11-6-10(21)13-15(22)8-4-3-5-9(20)16(8)24-17(13)14(11)18/h3-6,12,19-21H,7H2,1-2H3/t12-/m0/s1 |
| InChIKey | WUWFQFXQCQBPCA-LBPRGKRZSA-N |
| XLogP | 2.39 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|