C18H15NO5 — CID 101243979
6,11-dihydroxy-3,3-dimethyl-2,12-dihydropyrano[2,3-c]acridine-1,7-dione (PubChem CID 101243979) has the molecular formula C18H15NO5 and a molecular weight of 325.32 g/mol. Its IUPAC name is 6,11-dihydroxy-3,3-dimethyl-2,12-dihydropyrano[2,3-c]acridine-1,7-dione.
| Compound Name | 6,11-dihydroxy-3,3-dimethyl-2,12-dihydropyrano[2,3-c]acridine-1,7-dione |
|---|---|
| PubChem CID | 101243979 |
| Molecular Formula | C18H15NO5 |
| Molecular Weight | 325.32 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 6,11-dihydroxy-3,3-dimethyl-2,12-dihydropyrano[2,3-c]acridine-1,7-dione |
| SMILES | CC1(C)CC(=O)c2c(cc(O)c3c(=O)c4cccc(O)c4[nH]c23)O1 |
| InChI | InChI=1S/C18H15NO5/c1-18(2)7-11(22)13-12(24-18)6-10(21)14-16(13)19-15-8(17(14)23)4-3-5-9(15)20/h3-6,20-21H,7H2,1-2H3,(H,19,23) |
| InChIKey | KJOJTWDBXVDCNZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 99.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.32 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|