C24H19NO4 — CID 163098872
6,11-dihydroxy-3,3-dimethyl-5-phenyl-12H-pyrano[2,3-c]acridin-7-one (PubChem CID 163098872) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is 6,11-dihydroxy-3,3-dimethyl-5-phenyl-12H-pyrano[2,3-c]acridin-7-one.
| Compound Name | 6,11-dihydroxy-3,3-dimethyl-5-phenyl-12H-pyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 163098872 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | 6,11-dihydroxy-3,3-dimethyl-5-phenyl-12H-pyrano[2,3-c]acridin-7-one |
| SMILES | CC1(C)C=Cc2c(c(-c3ccccc3)c(O)c3c(=O)c4cccc(O)c4[nH]c23)O1 |
| InChI | InChI=1S/C24H19NO4/c1-24(2)12-11-15-20-18(21(27)14-9-6-10-16(26)19(14)25-20)22(28)17(23(15)29-24)13-7-4-3-5-8-13/h3-12,26,28H,1-2H3,(H,25,27) |
| InChIKey | OKQCZZWIGHSNHJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|