C20H20O — CID 22970322
6,6-dimethyl-7-oxapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),3(8),4,9,11,13-hexaene (PubChem CID 22970322) has the molecular formula C20H20O and a molecular weight of 276.38 g/mol. Its IUPAC name is 6,6-dimethyl-7-oxapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),3(8),4,9,11,13-hexaene.
| Compound Name | 6,6-dimethyl-7-oxapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),3(8),4,9,11,13-hexaene |
|---|---|
| PubChem CID | 22970322 |
| Molecular Formula | C20H20O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 6,6-dimethyl-7-oxapentacyclo[14.2.1.02,15.03,8.09,14]nonadeca-2(15),3(8),4,9,11,13-hexaene |
| SMILES | CC1(C)C=Cc2c3c(c4ccccc4c2O1)C1CCC3C1 |
| InChI | InChI=1S/C20H20O/c1-20(2)10-9-16-18-13-8-7-12(11-13)17(18)14-5-3-4-6-15(14)19(16)21-20/h3-6,9-10,12-13H,7-8,11H2,1-2H3 |
| InChIKey | GWVMMVNSDRQYGJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |