C20H21NO — CID 14191010
11-ethyl-3,3,5-trimethylpyrano[3,2-a]carbazole (PubChem CID 14191010) has the molecular formula C20H21NO and a molecular weight of 291.39 g/mol. Its IUPAC name is 11-ethyl-3,3,5-trimethylpyrano[3,2-a]carbazole.
| Compound Name | 11-ethyl-3,3,5-trimethylpyrano[3,2-a]carbazole |
|---|---|
| PubChem CID | 14191010 |
| Molecular Formula | C20H21NO |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 11-ethyl-3,3,5-trimethylpyrano[3,2-a]carbazole |
| SMILES | CCn1c2ccccc2c2cc(C)c3c(c21)C=CC(C)(C)O3 |
| InChI | InChI=1S/C20H21NO/c1-5-21-17-9-7-6-8-14(17)16-12-13(2)19-15(18(16)21)10-11-20(3,4)22-19/h6-12H,5H2,1-4H3 |
| InChIKey | UAECTGDPGIAHDK-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |