C34H29NO2 — CID 73388376
(E)-1-[6-(2-carbazol-9-ylethyl)-2,2-dimethylchromen-8-yl]-3-phenylprop-2-en-1-one (PubChem CID 73388376) has the molecular formula C34H29NO2 and a molecular weight of 483.61 g/mol. Its IUPAC name is (E)-1-[6-(2-carbazol-9-ylethyl)-2,2-dimethylchromen-8-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[6-(2-carbazol-9-ylethyl)-2,2-dimethylchromen-8-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 73388376 |
| Molecular Formula | C34H29NO2 |
| Molecular Weight | 483.61 g/mol |
| Exact Mass | 483.22 |
| IUPAC Name | (E)-1-[6-(2-carbazol-9-ylethyl)-2,2-dimethylchromen-8-yl]-3-phenylprop-2-en-1-one |
| SMILES | CC1(C)C=Cc2cc(CCn3c4ccccc4c4ccccc43)cc(C(=O)/C=C/c3ccccc3)c2O1 |
| InChI | InChI=1S/C34H29NO2/c1-34(2)20-18-26-22-25(23-29(33(26)37-34)32(36)17-16-24-10-4-3-5-11-24)19-21-35-30-14-8-6-12-27(30)28-13-7-9-15-31(28)35/h3-18,20,22-23H,19,21H2,1-2H3/b17-16+ |
| InChIKey | YRESUBWPBDDYGW-WUKNDPDISA-N |
| XLogP | 8.12 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.61 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|