C22H21NO3 — CID 54711057
1-butyl-4-hydroxy-3-(3-phenylprop-2-enoyl)quinolin-2-one (PubChem CID 54711057) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is 1-butyl-4-hydroxy-3-(3-phenylprop-2-enoyl)quinolin-2-one.
| Compound Name | 1-butyl-4-hydroxy-3-(3-phenylprop-2-enoyl)quinolin-2-one |
|---|---|
| PubChem CID | 54711057 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-butyl-4-hydroxy-3-(3-phenylprop-2-enoyl)quinolin-2-one |
| SMILES | CCCCn1c(=O)c(C(=O)C=Cc2ccccc2)c(O)c2ccccc21 |
| InChI | InChI=1S/C22H21NO3/c1-2-3-15-23-18-12-8-7-11-17(18)21(25)20(22(23)26)19(24)14-13-16-9-5-4-6-10-16/h4-14,25H,2-3,15H2,1H3 |
| InChIKey | OOYJNKMCFMHFEC-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|