C30H37N3O11 — CID 54681513
bis((E)-but-2-enedioic acid);1-butyl-4-hydroxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoquinoline-3-carboxamide (PubChem CID 54681513) has the molecular formula C30H37N3O11 and a molecular weight of 615.64 g/mol. Its IUPAC name is bis((E)-but-2-enedioic acid);1-butyl-4-hydroxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoquinoline-3-carboxamide.
| Compound Name | bis((E)-but-2-enedioic acid);1-butyl-4-hydroxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 54681513 |
| Molecular Formula | C30H37N3O11 |
| Molecular Weight | 615.64 g/mol |
| Exact Mass | 615.24 |
| IUPAC Name | bis((E)-but-2-enedioic acid);1-butyl-4-hydroxy-N-(8-methyl-8-azabicyclo[3.2.1]octan-3-yl)-2-oxoquinoline-3-carboxamide |
| SMILES | CCCCn1c(=O)c(C(=O)NC2CC3CCC(C2)N3C)c(O)c2ccccc21.O=C(O)/C=C/C(=O)O.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H29N3O3.2C4H4O4/c1-3-4-11-25-18-8-6-5-7-17(18)20(26)19(22(25)28)21(27)23-14-12-15-9-10-16(13-14)24(15)2;2*5-3(6)1-2-4(7)8/h5-8,14-16,26H,3-4,9-13H2,1-2H3,(H,23,27);2*1-2H,(H,5,6)(H,7,8)/b;2*2-1+ |
| InChIKey | WHCSIKWYBBYDCZ-LVEZLNDCSA-N |
| XLogP | 2.29 |
| TPSA | 223.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.64 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|