C20H21BrO2 — CID 91144984
5-bromo-4,4,10,10-tetramethyl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),11,14,16-hexaene (PubChem CID 91144984) has the molecular formula C20H21BrO2 and a molecular weight of 373.29 g/mol. Its IUPAC name is 5-bromo-4,4,10,10-tetramethyl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),11,14,16-hexaene.
| Compound Name | 5-bromo-4,4,10,10-tetramethyl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),11,14,16-hexaene |
|---|---|
| PubChem CID | 91144984 |
| Molecular Formula | C20H21BrO2 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.07 |
| IUPAC Name | 5-bromo-4,4,10,10-tetramethyl-3,9-dioxatetracyclo[12.4.0.02,7.08,13]octadeca-1(18),2(7),8(13),11,14,16-hexaene |
| SMILES | CC1(C)C=Cc2c(c3c(c4ccccc24)OC(C)(C)C(Br)C3)O1 |
| InChI | InChI=1S/C20H21BrO2/c1-19(2)10-9-14-12-7-5-6-8-13(12)18-15(17(14)22-19)11-16(21)20(3,4)23-18/h5-10,16H,11H2,1-4H3 |
| InChIKey | REJHZGVLFQGHBI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|