C18H16BrNO2 — CID 54768504
2-bromo-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde (PubChem CID 54768504) has the molecular formula C18H16BrNO2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-bromo-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde.
| Compound Name | 2-bromo-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde |
|---|---|
| PubChem CID | 54768504 |
| Molecular Formula | C18H16BrNO2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 2-bromo-3,3-dimethyl-2,11-dihydro-1H-pyrano[3,2-a]carbazole-5-carbaldehyde |
| SMILES | CC1(C)Oc2c(C=O)cc3c([nH]c4ccccc43)c2CC1Br |
| InChI | InChI=1S/C18H16BrNO2/c1-18(2)15(19)8-13-16-12(7-10(9-21)17(13)22-18)11-5-3-4-6-14(11)20-16/h3-7,9,15,20H,8H2,1-2H3 |
| InChIKey | GWOJXOIWQKOVEE-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|