C13H10N2O — CID 82394891
3-methyl-9H-pyrido[3,4-b]indole-1-carbaldehyde (PubChem CID 82394891) has the molecular formula C13H10N2O and a molecular weight of 210.24 g/mol. Its IUPAC name is 3-methyl-9H-pyrido[3,4-b]indole-1-carbaldehyde.
| Compound Name | 3-methyl-9H-pyrido[3,4-b]indole-1-carbaldehyde |
|---|---|
| PubChem CID | 82394891 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 3-methyl-9H-pyrido[3,4-b]indole-1-carbaldehyde |
| SMILES | Cc1cc2c([nH]c3ccccc32)c(C=O)n1 |
| InChI | InChI=1S/C13H10N2O/c1-8-6-10-9-4-2-3-5-11(9)15-13(10)12(7-16)14-8/h2-7,15H,1H3 |
| InChIKey | DVOWJWYLQFUIAX-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|