C18H15NO2 — CID 162837479
3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one (PubChem CID 162837479) has the molecular formula C18H15NO2 and a molecular weight of 277.32 g/mol. Its IUPAC name is 3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one.
| Compound Name | 3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
|---|---|
| PubChem CID | 162837479 |
| Molecular Formula | C18H15NO2 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3,3-dimethyl-12H-pyrano[2,3-c]acridin-7-one |
| SMILES | CC1(C)C=Cc2c(ccc3c(=O)c4ccccc4[nH]c23)O1 |
| InChI | InChI=1S/C18H15NO2/c1-18(2)10-9-12-15(21-18)8-7-13-16(12)19-14-6-4-3-5-11(14)17(13)20/h3-10H,1-2H3,(H,19,20) |
| InChIKey | KTYOMDAQMUMSNR-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|