C16H16O3 — CID 11357304
2-ethyl-8,8-dimethylpyrano[2,3-f]chromen-4-one (PubChem CID 11357304) has the molecular formula C16H16O3 and a molecular weight of 256.30 g/mol. Its IUPAC name is 2-ethyl-8,8-dimethylpyrano[2,3-f]chromen-4-one.
| Compound Name | 2-ethyl-8,8-dimethylpyrano[2,3-f]chromen-4-one |
|---|---|
| PubChem CID | 11357304 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2-ethyl-8,8-dimethylpyrano[2,3-f]chromen-4-one |
| SMILES | CCc1cc(=O)c2ccc3c(c2o1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C16H16O3/c1-4-10-9-13(17)11-5-6-14-12(15(11)18-10)7-8-16(2,3)19-14/h5-9H,4H2,1-3H3 |
| InChIKey | ZDNYUBBRJOOPJA-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |