C21H23NO — CID 122400211
9-butyl-3,3-dimethyl-7H-pyrano[2,3-c]carbazole (PubChem CID 122400211) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is 9-butyl-3,3-dimethyl-7H-pyrano[2,3-c]carbazole.
| Compound Name | 9-butyl-3,3-dimethyl-7H-pyrano[2,3-c]carbazole |
|---|---|
| PubChem CID | 122400211 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 9-butyl-3,3-dimethyl-7H-pyrano[2,3-c]carbazole |
| SMILES | CCCCc1ccc2c(c1)[nH]c1ccc3c(c12)C=CC(C)(C)O3 |
| InChI | InChI=1S/C21H23NO/c1-4-5-6-14-7-8-15-18(13-14)22-17-9-10-19-16(20(15)17)11-12-21(2,3)23-19/h7-13,22H,4-6H2,1-3H3 |
| InChIKey | GBWJDOVSRQCODR-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |