C32H34O3 — CID 139397836
8,8-dimethyl-3-(4-pentyl-2-phenylmethoxyphenyl)-2H-pyrano[2,3-f]chromene (PubChem CID 139397836) has the molecular formula C32H34O3 and a molecular weight of 466.62 g/mol. Its IUPAC name is 8,8-dimethyl-3-(4-pentyl-2-phenylmethoxyphenyl)-2H-pyrano[2,3-f]chromene.
| Compound Name | 8,8-dimethyl-3-(4-pentyl-2-phenylmethoxyphenyl)-2H-pyrano[2,3-f]chromene |
|---|---|
| PubChem CID | 139397836 |
| Molecular Formula | C32H34O3 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | 8,8-dimethyl-3-(4-pentyl-2-phenylmethoxyphenyl)-2H-pyrano[2,3-f]chromene |
| SMILES | CCCCCc1ccc(C2=Cc3ccc4c(c3OC2)C=CC(C)(C)O4)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H34O3/c1-4-5-7-10-23-13-15-27(30(19-23)33-21-24-11-8-6-9-12-24)26-20-25-14-16-29-28(31(25)34-22-26)17-18-32(2,3)35-29/h6,8-9,11-20H,4-5,7,10,21-22H2,1-3H3 |
| InChIKey | CWWLBLULCNTVMR-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|