C30H30O5 — CID 150377710
3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propylphenyl)prop-2-enoic acid (PubChem CID 150377710) has the molecular formula C30H30O5 and a molecular weight of 470.57 g/mol. Its IUPAC name is 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propylphenyl)prop-2-enoic acid.
| Compound Name | 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propylphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 150377710 |
| Molecular Formula | C30H30O5 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propylphenyl)prop-2-enoic acid |
| SMILES | CCCc1ccc(C(=Cc2ccc3c(c2O)C=CC(C)(C)O3)C(=O)O)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C30H30O5/c1-4-8-20-11-13-23(27(17-20)34-19-21-9-6-5-7-10-21)25(29(32)33)18-22-12-14-26-24(28(22)31)15-16-30(2,3)35-26/h5-7,9-18,31H,4,8,19H2,1-3H3,(H,32,33) |
| InChIKey | GZBCJOPPEBZYRR-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|