C31H32O6 — CID 122531286
methyl 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 122531286) has the molecular formula C31H32O6 and a molecular weight of 500.59 g/mol. Its IUPAC name is methyl 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | methyl 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 122531286 |
| Molecular Formula | C31H32O6 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | methyl 3-(5-hydroxy-2,2-dimethylchromen-6-yl)-2-(2-phenylmethoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(C(=Cc2ccc3c(c2O)C=CC(C)(C)O3)C(=O)OC)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H32O6/c1-5-17-35-23-12-13-24(28(19-23)36-20-21-9-7-6-8-10-21)26(30(33)34-4)18-22-11-14-27-25(29(22)32)15-16-31(2,3)37-27/h6-16,18-19,32H,5,17,20H2,1-4H3 |
| InChIKey | RDLDSQZKXPXCAY-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|