C31H34O4 — CID 137440399
3-(4-butoxy-2-phenylmethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromene (PubChem CID 137440399) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 3-(4-butoxy-2-phenylmethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromene.
| Compound Name | 3-(4-butoxy-2-phenylmethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromene |
|---|---|
| PubChem CID | 137440399 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 3-(4-butoxy-2-phenylmethoxyphenyl)-8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromene |
| SMILES | CCCCOc1ccc(C2COc3c(ccc4c3C=CC(C)(C)O4)C2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C31H34O4/c1-4-5-17-32-25-12-13-26(29(19-25)33-20-22-9-7-6-8-10-22)24-18-23-11-14-28-27(30(23)34-21-24)15-16-31(2,3)35-28/h6-16,19,24H,4-5,17-18,20-21H2,1-3H3 |
| InChIKey | AWZXVDKRWWGQAT-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|