C48H82N6O4 — CID 164940284
N'-[4-[3-[4-[bis[3-(dimethylamino)propyl]amino]butoxy]-4-(8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl)phenoxy]butyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine (PubChem CID 164940284) has the molecular formula C48H82N6O4 and a molecular weight of 807.22 g/mol. Its IUPAC name is N'-[4-[3-[4-[bis[3-(dimethylamino)propyl]amino]butoxy]-4-(8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl)phenoxy]butyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine.
| Compound Name | N'-[4-[3-[4-[bis[3-(dimethylamino)propyl]amino]butoxy]-4-(8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl)phenoxy]butyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 164940284 |
| Molecular Formula | C48H82N6O4 |
| Molecular Weight | 807.22 g/mol |
| Exact Mass | 806.64 |
| IUPAC Name | N'-[4-[3-[4-[bis[3-(dimethylamino)propyl]amino]butoxy]-4-(8,8-dimethyl-3,4-dihydro-2H-pyrano[2,3-f]chromen-3-yl)phenoxy]butyl]-N'-[3-(dimethylamino)propyl]-N,N-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN(CCCCOc1ccc(C2COc3c(ccc4c3C=CC(C)(C)O4)C2)c(OCCCCN(CCCN(C)C)CCCN(C)C)c1)CCCN(C)C |
| InChI | InChI=1S/C48H82N6O4/c1-48(2)24-23-44-45(58-48)22-19-40-37-41(39-57-47(40)44)43-21-20-42(55-35-13-11-29-53(31-15-25-49(3)4)32-16-26-50(5)6)38-46(43)56-36-14-12-30-54(33-17-27-51(7)8)34-18-28-52(9)10/h19-24,38,41H,11-18,25-37,39H2,1-10H3 |
| InChIKey | YHMQYGJAEDAREM-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 56.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 807.22 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|