C24H26O3 — CID 163486795
3-(4-butoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene (PubChem CID 163486795) has the molecular formula C24H26O3 and a molecular weight of 362.47 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene.
| Compound Name | 3-(4-butoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene |
|---|---|
| PubChem CID | 163486795 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 3-(4-butoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene |
| SMILES | CCCCOc1ccc(C2=Cc3ccc4c(c3OC2)C=CC(C)(C)O4)cc1 |
| InChI | InChI=1S/C24H26O3/c1-4-5-14-25-20-9-6-17(7-10-20)19-15-18-8-11-22-21(23(18)26-16-19)12-13-24(2,3)27-22/h6-13,15H,4-5,14,16H2,1-3H3 |
| InChIKey | LLQSYHHHOPTOSU-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|