C22H22O6S — CID 142227179
[3-(5-methoxy-2,2-dimethylchromen-6-yl)-2H-chromen-7-yl] methanesulfonate (PubChem CID 142227179) has the molecular formula C22H22O6S and a molecular weight of 414.48 g/mol. Its IUPAC name is [3-(5-methoxy-2,2-dimethylchromen-6-yl)-2H-chromen-7-yl] methanesulfonate.
| Compound Name | [3-(5-methoxy-2,2-dimethylchromen-6-yl)-2H-chromen-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 142227179 |
| Molecular Formula | C22H22O6S |
| Molecular Weight | 414.48 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [3-(5-methoxy-2,2-dimethylchromen-6-yl)-2H-chromen-7-yl] methanesulfonate |
| SMILES | COc1c(C2=Cc3ccc(OS(C)(=O)=O)cc3OC2)ccc2c1C=CC(C)(C)O2 |
| InChI | InChI=1S/C22H22O6S/c1-22(2)10-9-18-19(27-22)8-7-17(21(18)25-3)15-11-14-5-6-16(28-29(4,23)24)12-20(14)26-13-15/h5-12H,13H2,1-4H3 |
| InChIKey | NTAUYDDYWSNRDI-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|