About 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene
3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene (PubChem CID 161405834) has the molecular formula C29H28O3
and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene.
Molecular Properties
| Compound Name | 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene |
| PubChem CID | 161405834 |
| Molecular Formula | C29H28O3 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene |
| SMILES | CCOc1ccc(C2=Cc3ccc4c(c3OC2)C=CC(C)(C)O4)c(Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H28O3/c1-4-30-24-11-12-25(22(18-24)16-20-8-6-5-7-9-20)23-17-21-10-13-27-26(28(21)31-19-23)14-15-29(2,3)32-27/h5-15,17-18H,4,16,19H2,1-3H3 |
| InChIKey | MJJVCCUAEVQLAH-UHFFFAOYSA-N |
| XLogP | 6.79 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene?
The IUPAC name of 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene (CID 161405834) is 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene.
What is the SMILES notation for 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene?
The canonical SMILES for 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene is CCOc1ccc(C2=Cc3ccc4c(c3OC2)C=CC(C)(C)O4)c(Cc2ccccc2)c1.
What is the InChIKey of 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene?
The InChIKey is MJJVCCUAEVQLAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28O3/c1-4-30-24-11-12-25(22(18-24)16-20-8-6-5-7-9-20)23-17-21-10-13-27-26(28(21)31-19-23)14-15-29(2,3)32-27/h5-15,17-18H,4,16,19H2,1-3H3.
What are the key properties of 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene?
3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene has a molecular weight of 424.54 g/mol, XLogP of 6.79, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-benzyl-4-ethoxyphenyl)-8,8-dimethyl-2H-pyrano[2,3-f]chromene is sourced from PubChem (CID 161405834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).