C27H27NO4 — CID 59711015
(4-ethoxyphenyl)methyl N-(2,2-dimethyl-8-phenylchromen-6-yl)carbamate (PubChem CID 59711015) has the molecular formula C27H27NO4 and a molecular weight of 429.52 g/mol. Its IUPAC name is (4-ethoxyphenyl)methyl N-(2,2-dimethyl-8-phenylchromen-6-yl)carbamate.
| Compound Name | (4-ethoxyphenyl)methyl N-(2,2-dimethyl-8-phenylchromen-6-yl)carbamate |
|---|---|
| PubChem CID | 59711015 |
| Molecular Formula | C27H27NO4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | (4-ethoxyphenyl)methyl N-(2,2-dimethyl-8-phenylchromen-6-yl)carbamate |
| SMILES | CCOc1ccc(COC(=O)Nc2cc3c(c(-c4ccccc4)c2)OC(C)(C)C=C3)cc1 |
| InChI | InChI=1S/C27H27NO4/c1-4-30-23-12-10-19(11-13-23)18-31-26(29)28-22-16-21-14-15-27(2,3)32-25(21)24(17-22)20-8-6-5-7-9-20/h5-17H,4,18H2,1-3H3,(H,28,29) |
| InChIKey | NMAAMTUFVPHOHR-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |