C22H28N2O4 — CID 5025804
benzyl N-[1-(4-ethoxyanilino)-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 5025804) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is benzyl N-[1-(4-ethoxyanilino)-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(4-ethoxyanilino)-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 5025804 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | benzyl N-[1-(4-ethoxyanilino)-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCOc1ccc(NC(=O)C(NC(=O)OCc2ccccc2)C(C)CC)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-4-16(3)20(24-22(26)28-15-17-9-7-6-8-10-17)21(25)23-18-11-13-19(14-12-18)27-5-2/h6-14,16,20H,4-5,15H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | CEZZEQRJBWMRBT-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |