C20H22FN3O5 — CID 9207732
benzyl N-[(2S,3S)-1-(4-fluoro-3-nitroanilino)-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 9207732) has the molecular formula C20H22FN3O5 and a molecular weight of 403.41 g/mol. Its IUPAC name is benzyl N-[(2S,3S)-1-(4-fluoro-3-nitroanilino)-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | benzyl N-[(2S,3S)-1-(4-fluoro-3-nitroanilino)-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 9207732 |
| Molecular Formula | C20H22FN3O5 |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | benzyl N-[(2S,3S)-1-(4-fluoro-3-nitroanilino)-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCc1ccccc1)C(=O)Nc1ccc(F)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H22FN3O5/c1-3-13(2)18(23-20(26)29-12-14-7-5-4-6-8-14)19(25)22-15-9-10-16(21)17(11-15)24(27)28/h4-11,13,18H,3,12H2,1-2H3,(H,22,25)(H,23,26)/t13-,18-/m0/s1 |
| InChIKey | YPWQCIYQLPFRIG-UGSOOPFHSA-N |
| XLogP | 4.01 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|