C21H20O5 — CID 139568713
4-(5-methoxy-8,8-dimethyl-2H-pyrano[2,3-h]chromen-3-yl)benzene-1,3-diol (PubChem CID 139568713) has the molecular formula C21H20O5 and a molecular weight of 352.39 g/mol. Its IUPAC name is 4-(5-methoxy-8,8-dimethyl-2H-pyrano[2,3-h]chromen-3-yl)benzene-1,3-diol.
| Compound Name | 4-(5-methoxy-8,8-dimethyl-2H-pyrano[2,3-h]chromen-3-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 139568713 |
| Molecular Formula | C21H20O5 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 4-(5-methoxy-8,8-dimethyl-2H-pyrano[2,3-h]chromen-3-yl)benzene-1,3-diol |
| SMILES | COc1cc2c(c3c1C=C(c1ccc(O)cc1O)CO3)C=CC(C)(C)O2 |
| InChI | InChI=1S/C21H20O5/c1-21(2)7-6-15-19(26-21)10-18(24-3)16-8-12(11-25-20(15)16)14-5-4-13(22)9-17(14)23/h4-10,22-23H,11H2,1-3H3 |
| InChIKey | ZNUHYVXKEZPDTB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|