C23H20O8 — CID 162820552
6,7-dimethoxy-8',8'-dimethylspiro[2H-chromene-3,2'-pyrano[2,3-h][1,3]benzodioxine]-4,4'-dione (PubChem CID 162820552) has the molecular formula C23H20O8 and a molecular weight of 424.41 g/mol. Its IUPAC name is 6,7-dimethoxy-8',8'-dimethylspiro[2H-chromene-3,2'-pyrano[2,3-h][1,3]benzodioxine]-4,4'-dione.
| Compound Name | 6,7-dimethoxy-8',8'-dimethylspiro[2H-chromene-3,2'-pyrano[2,3-h][1,3]benzodioxine]-4,4'-dione |
|---|---|
| PubChem CID | 162820552 |
| Molecular Formula | C23H20O8 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | 6,7-dimethoxy-8',8'-dimethylspiro[2H-chromene-3,2'-pyrano[2,3-h][1,3]benzodioxine]-4,4'-dione |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(CO2)OC(=O)c2ccc3c(c2O1)C=CC(C)(C)O3 |
| InChI | InChI=1S/C23H20O8/c1-22(2)8-7-12-15(29-22)6-5-13-19(12)30-23(31-21(13)25)11-28-16-10-18(27-4)17(26-3)9-14(16)20(23)24/h5-10H,11H2,1-4H3 |
| InChIKey | NZIANEPQOIXOGI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |