About 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol
4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol (PubChem CID 134419112) has the molecular formula C27H24O4
and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol.
Molecular Properties
| Compound Name | 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol |
| PubChem CID | 134419112 |
| Molecular Formula | C27H24O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol |
| SMILES | CC1(C)C=Cc2c(ccc3c2OCC(c2ccc(O)cc2OCc2ccccc2)=C3)O1 |
| InChI | InChI=1S/C27H24O4/c1-27(2)13-12-23-24(31-27)11-8-19-14-20(17-30-26(19)23)22-10-9-21(28)15-25(22)29-16-18-6-4-3-5-7-18/h3-15,28H,16-17H2,1-2H3 |
| InChIKey | VMGRTMNIQGONOS-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol?
The IUPAC name of 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol (CID 134419112) is 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol.
What is the SMILES notation for 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol?
The canonical SMILES for 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol is CC1(C)C=Cc2c(ccc3c2OCC(c2ccc(O)cc2OCc2ccccc2)=C3)O1.
What is the InChIKey of 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol?
The InChIKey is VMGRTMNIQGONOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H24O4/c1-27(2)13-12-23-24(31-27)11-8-19-14-20(17-30-26(19)23)22-10-9-21(28)15-25(22)29-16-18-6-4-3-5-7-18/h3-15,28H,16-17H2,1-2H3.
What are the key properties of 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol?
4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol has a molecular weight of 412.49 g/mol, XLogP of 6.09, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8,8-dimethyl-2H-pyrano[2,3-f]chromen-3-yl)-3-phenylmethoxyphenol is sourced from PubChem (CID 134419112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).